| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| Merck Millipore | USA | |||
|---|---|---|---|---|
![]() |
+86 (10) 5989-8600 | |||
![]() |
asiatechserv@millipore.com | |||
| Chemical manufacturer since 1954 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | (Z)-Benzylidene-Oxido-Tert-Butyl-Azanium |
|---|---|
| Synonyms | N-Tert-Butyl-1-Phenyl-Methanimine Oxide; Alpha-Phenyl-N-T-Butylnitrone; Alpha-Phenyl-N-Tert-Butylnitrone |
| Molecular Structure | ![]() |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 |
| CAS Registry Number | 68315-30-0 |
| SMILES | C1=C(C=[N+](C(C)(C)C)[O-])C=CC=C1 |
| InChI | 1S/C11H15NO/c1-11(2,3)12(13)9-10-7-5-4-6-8-10/h4-9H,1-3H3 |
| InChIKey | IYSYLWYGCWTJSG-UHFFFAOYSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 74°C (Expl.) |
| Boiling point | 283.3±23.0°C at 760 mmHg (Cal.) |
| Flash point | 118.5±15.4°C (Cal.) |
| Safety Description | CAUTION: May irritate eyes, skin, and respiratory tract |
|---|---|
| (1) | Stefano LivraghiThese authors contributed equally to the study., Ingrid Corazzari, Maria Cristina Paganini, Giacomo Ceccone, Elio Giamello, Bice Fubini and Ivana Fenoglio. Decreasing the oxidative potential of TiO nanoparticles through modification of the surface with carbon: a new strategy for the production of safe UV filters, Chem. Commun., 2010, 46, 8478. |
|---|---|
| Market Analysis Reports |