| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| ChemDiv, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 794-4860 | |||
![]() |
chemdiv@chemdiv.com | |||
| Chemical manufacturer | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Specs Ltd. | Netherlands | |||
|---|---|---|---|---|
![]() |
+31 (15) 251-8111 | |||
![]() |
info@specs.net | |||
| Chemical manufacturer since 1987 | ||||
| Vitas-M | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (906) 781-2021 | |||
![]() |
vitas@vitasmlab.com | |||
| Chemical manufacturer since 1998 | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | N-Benzylidene-1-Napthylamine |
|---|---|
| Synonyms | N-(1-Naphthyl)-1-Phenyl-Methanimine; N-(1-Naphthyl)-1-Phenylmethanimine; Benzylidene-(1-Naphthyl)Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C17H13N |
| Molecular Weight | 231.30 |
| CAS Registry Number | 890-51-7 |
| SMILES | C1=CC=CC2=C1C(=CC=C2)N=CC3=CC=CC=C3 |
| InChI | 1S/C17H13N/c1-2-7-14(8-3-1)13-18-17-12-6-10-15-9-4-5-11-16(15)17/h1-13H |
| InChIKey | NQPYSYDZNCHIQY-UHFFFAOYSA-N |
| Density | 1.026g/cm3 (Cal.) |
|---|---|
| Boiling point | 400.511°C at 760 mmHg (Cal.) |
| Flash point | 188.505°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Hania M M. Synthesis of some imines and investigation of their biological activity, E-Journal of Chemistry 2009, 6(3), 629-632 |
|---|---|
| Market Analysis Reports |