| The Dow Chemical Company | USA | |||
|---|---|---|---|---|
![]() | www.dow.com | |||
![]() | +1 (989) 633-1706 | |||
![]() | fmdcigs@dow.com | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2012 | ||||
| Name | Ethoxylated propoxylated di-sec-butylphenol |
|---|---|
| Synonyms | Oxirane polymer with methyloxirane mono[bis(1-methylpropyl)phenyl] ether; PG 26-2; PG 26-3; Polyglycol 26-2; Polyglycol 26-3 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H22O.(C3H6O)n.(C2H4O)x |
| CAS Registry Number | 69029-39-6 |
| EC Number | 685-292-3 |
| Hazard Classification | |||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| |||||||||||||
| Market Analysis Reports |