|
CAS#: 7261-26-9 Product: D-Xylopyranose No suppilers available for the product. |
| Name | D-Xylopyranose |
|---|---|
| Synonyms | (3R,4S,5R)-tetrahydro-2H-pyran-2,3,4,5-tetraol; (3R,4S,5R)-tetrahydro-2H-pyran-2,3,4,5-tetrol; a,ß-d-xylopyranose |
| Molecular Structure | ![]() |
| Molecular Formula | C5H10O5 |
| Molecular Weight | 150.13 |
| CAS Registry Number | 7261-26-9 |
| SMILES | C1[C@H]([C@@H]([C@H](C(O1)O)O)O)O |
| InChI | 1S/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3+,4-,5?/m1/s1 |
| InChIKey | SRBFZHDQGSBBOR-IOVATXLUSA-N |
| Density | 1.8±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 333.2±42.0°C at 760 mmHg (Cal.) |
| Flash point | 155.3±27.9°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Edwin C. Constable, Catherine E. Housecroft, Markus Neuburger and Pirmin Rösel. Clicking hard-core sugar balls, Chem. Commun., 2010, 46, 1628. |
|---|---|
| Market Analysis Reports |