| Interbioscreen Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (49) 6524-0091 | |||
![]() |
screen@ibscreen.chg.ru | |||
| Chemical manufacturer | ||||
| Trylead Chemical Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (571) 8708-6220 | |||
![]() |
info@trylead-chem.com | |||
| Chemical manufacturer since 2006 | ||||
| Zylexa Pharma Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 2-(alpha-Anilinobenzyl)-Cyclohexanone |
|---|---|
| Synonyms | 2-[Phenyl-(Phenylamino)Methyl]-1-Cyclohexanone; 2-(A-Anilinobenzyl)-1-Cyclohexanone; Cyclohexanone, 2-(.Alpha.-Anilinobenzyl)- |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 |
| CAS Registry Number | 737-47-3 |
| SMILES | C3=C(C(NC1=CC=CC=C1)C2C(=O)CCCC2)C=CC=C3 |
| InChI | 1S/C19H21NO/c21-18-14-8-7-13-17(18)19(15-9-3-1-4-10-15)20-16-11-5-2-6-12-16/h1-6,9-12,17,19-20H,7-8,13-14H2 |
| InChIKey | ITYLIHBJQIGSFJ-UHFFFAOYSA-N |
| Density | 1.136g/cm3 (Cal.) |
|---|---|
| Boiling point | 440.71°C at 760 mmHg (Cal.) |
| Flash point | 154.034°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Shoichi Shimizu, Naoyuki Shimada and Yasuyuki Sasaki. Mannich-type reactions in water using anionic water-soluble calixarenes as recoverable and reusable catalysts, Green Chem., 2006, 8, 608. |
|---|---|
| Market Analysis Reports |