| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 2-Anilino-4,6-bis(2-methyl-2-propanyl)phenol |
|---|---|
| Synonyms | 2,4-di-tert-butyl-6-(phenylamino)phenol; 2-anilino-4,6-di(tert-butyl)phenol |
| Molecular Structure | ![]() |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.43 |
| CAS Registry Number | 94876-25-2 |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)NC2=CC=CC=C2)O)C(C)(C)C |
| InChI | 1S/C20H27NO/c1-19(2,3)14-12-16(20(4,5)6)18(22)17(13-14)21-15-10-8-7-9-11-15/h7-13,21-22H,1-6H3 |
| InChIKey | KFQVMAWFWXYDFH-UHFFFAOYSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 370.8±42.0°C at 760 mmHg (Cal.) |
| Flash point | 34.7±18.5°C (Cal.) |
| (1) | Kil Sik Min, Thomas Weyhermüller and Karl Wieghardt. O,N-Coordinated o-iminobenzoquinone and o-iminobenzosemiquinonato(1-) ligands in complexes of Ni(ii), Co(iii) and Fe(iii), Dalton Trans., 2003, 0, 1126. |
|---|---|
| Market Analysis Reports |