|
CAS#: 9007-69-6 Product: 2,5-Furandione polymer with ethene, ammonium salt No suppilers available for the product. |
| Name | 2,5-Furandione polymer with ethene, ammonium salt |
|---|---|
| Synonyms | Furan-2,5-Dione; Vinylammonium; Furan-2,5-Quinone; Vinylammonium; 2,5-Furandione, Polymer With Ethene, Ammonium Salt |
| Molecular Formula | C6H8NO3 |
| Molecular Weight | 142.13 |
| CAS Registry Number | 9007-69-6 |
| SMILES | O=C1OC(=O)C=C1.C([NH3+])=C |
| InChI | 1S/C4H2O3.C2H5N/c5-3-1-2-4(6)7-3;1-2-3/h1-2H;2H,1,3H2/p+1 |
| InChIKey | BVJCFXQLJWHELX-UHFFFAOYSA-O |
| Boiling point | 202°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 103.3°C (Cal.) |
| Market Analysis Reports |