|
CAS#: 9011-01-2 Product: 2,5-Furandione polymer with ethene and ethenyl 2-buteneoate No suppilers available for the product. |
| Name | 2,5-Furandione polymer with ethene and ethenyl 2-buteneoate |
|---|---|
| Synonyms | Ethylene; Furan-2,5-Dione; Vinyl (E)-But-2-Enoate; (E)-But-2-Enoic Acid Vinyl Ester; Ethylene; Furan-2,5-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 |
| CAS Registry Number | 9011-01-2 (29535-27-1) |
| SMILES | O=C1OC(=O)C=C1.C/C=C/C(OC=C)=O.C=C |
| InChI | 1S/C6H8O2.C4H2O3.C2H4/c1-3-5-6(7)8-4-2;5-3-1-2-4(6)7-3;1-2/h3-5H,2H2,1H3;1-2H;1-2H2/b5-3+;; |
| InChIKey | XOYZXBWFPQSUTG-RQCPZROWSA-N |
| Boiling point | 133°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 27.2°C (Cal.) |
| Market Analysis Reports |