| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Biosynth AG. | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (71) 858-2020 | |||
![]() |
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| Classification | Flavors and spices >> Synthetic spice >> Carboxylic acid and ester perfume >> Aliphatic carboxylate |
|---|---|
| Name | 3A,4,5,6,7,7alpha-Hexahydro-4,7-Methano-1H-Inden-6-Ol 6-Propanoate |
| Synonyms | 4,7-Methanoinden-6-Ol, 3A,4,5,6,7,7A-Hexahydro-, Propionate; 4,7-Methanoinden-6-Ol, 3A,4,5,6,7,7A-Hexahydro-, Propionate (8Ci); 4,7-Methanoindene-6-Carboxylic Acid, 3A,4,5,6,7,7A-Hexahydro-, Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 |
| CAS Registry Number | 17511-60-3 |
| EINECS | 241-514-7 |
| SMILES | C(C(OC2C1C3C(C(C1)C2)C=CC3)=O)C |
| InChI | 1S/C13H18O2/c1-2-13(14)15-12-7-8-6-11(12)10-5-3-4-9(8)10/h3-4,8-12H,2,5-7H2,1H3 |
| InChIKey | BLBJUGKATXCWET-UHFFFAOYSA-N |
| Density | 1.105g/cm3 (Cal.) |
|---|---|
| Boiling point | 276.155°C at 760 mmHg (Cal.) |
| Flash point | 112.864°C (Cal.) |
| Market Analysis Reports |