| Leap Chem Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (852) 3060-6658 | |||
![]() |
market19@leapchem.com | |||
![]() |
QQ Chat | |||
| Chemical distributor since 2006 | ||||
| chemBlink massive supplier since 2022 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Biosynth AG. | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (71) 858-2020 | |||
![]() |
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| Simagchem Corporation | China | |||
|---|---|---|---|---|
![]() |
+86 13806087780 | |||
![]() |
sale@simagchem.com | |||
| Chemical manufacturer since 2002 | ||||
| chemBlink premium supplier since 2020 | ||||
| Classification | Flavors and spices >> Synthetic spice >> Carboxylic acid and ester perfume >> Aliphatic carboxylate |
|---|---|
| Name | 3alpha,4,5,6,7,7alpha-Hexahydro-4,7-Methano-1H-Inden-6-Ol 6-Acetate |
| Synonyms | Nsc 6598; 3A,4,5,6,7,7A-Hexahydro-1H-4,7-Methanoinden-6-Yl Acetate; Tricyclodecen-4-Yl 8-Acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 |
| CAS Registry Number | 5413-60-5 |
| EINECS | 226-501-6 |
| SMILES | CC(OC3C2C1C(C=CC1)C(C2)C3)=O |
| InChI | 1S/C12H16O2/c1-7(13)14-12-6-8-5-11(12)10-4-2-3-9(8)10/h2-3,8-12H,4-6H2,1H3 |
| InChIKey | RGVQNSFGUOIKFF-UHFFFAOYSA-N |
| Density | 1.129g/cm3 (Cal.) |
|---|---|
| Boiling point | 258.415°C at 760 mmHg (Cal.) |
| Flash point | 101.757°C (Cal.) |
| Market Analysis Reports |