| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Biosynth AG. | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (71) 858-2020 | |||
![]() |
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Classification | Flavors and spices >> Synthetic spice >> Carboxylic acid and ester perfume >> Aliphatic carboxylate |
|---|---|
| Name | 3alpha,4,5,6,7,7alpha-Hexahydro-4,7-Methano-1H-Inden-5-Ol 5-Acetate |
| Synonyms | 4,7-Methano-1H-Inden-5-Ol, 3A,4,5,6,7,7A-Hexahydro-, Acetate; 4,7-Methanoinden-5-Ol, 3A,4,5,6,7,7A-Hexahydro-, Acetate; Nsc142428 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 |
| CAS Registry Number | 2500-83-6 |
| EINECS | 219-700-4 |
| SMILES | CC(OC3C2C1C(CC=C1)C(C2)C3)=O |
| InChI | 1S/C12H16O2/c1-7(13)14-12-6-8-5-11(12)10-4-2-3-9(8)10/h2,4,8-12H,3,5-6H2,1H3 |
| InChIKey | BJLRAKFWOUAROE-UHFFFAOYSA-N |
| Density | 1.129g/cm3 (Cal.) |
|---|---|
| Boiling point | 258.415°C at 760 mmHg (Cal.) |
| Flash point | 101.757°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |