|
CAS#: 51838-29-0 Product: 1,2-Propanediol, 2,2-Dimethyl-1,3-Propanediol, 2,5-Furandione Polymer No suppilers available for the product. |
| Name | 1,2-Propanediol, 2,2-Dimethyl-1,3-Propanediol, 2,5-Furandione Polymer |
|---|---|
| Synonyms | 2,2-Dimethylpropane-1,3-Diol; Furan-2,5-Quinone; Propane-1,2-Diol; 1,2-Propanediol, 2,2-Dimethyl-1,3-Propanediol, 2,5-Furandione Polymer; 2,5-Furandione, Polymer With 2,2-Dimethyl-1,3-Propanediol And 1,2-Propanediol |
| Molecular Formula | C12H22O7 |
| Molecular Weight | 278.30 |
| CAS Registry Number | 51838-29-0 |
| SMILES | O=C1OC(=O)C=C1.C(O)C(CO)(C)C.C(O)C(O)C |
| InChI | 1S/C5H12O2.C4H2O3.C3H8O2/c1-5(2,3-6)4-7;5-3-1-2-4(6)7-3;1-3(5)2-4/h6-7H,3-4H2,1-2H3;1-2H;3-5H,2H2,1H3 |
| InChIKey | UTICFIDXXVGEPY-UHFFFAOYSA-N |
| Boiling point | 209.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 107.2°C (Cal.) |
| Market Analysis Reports |