| AccuStandard Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (203) 786-5290 | |||
![]() |
orders@accustandard.com | |||
| Chemical manufacturer since 1986 | ||||
| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Classification | Organic raw materials >> Inorganic acid ester |
|---|---|
| Name | 1,2-Propanediol Dinitrate |
| Synonyms | (1-Methyl-2-Nitrooxy-Ethyl) Nitrate; Nitric Acid (1-Methyl-2-Nitrooxyethyl) Ester; Nitric Acid (1-Methyl-2-Nitrooxy-Ethyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C3H6N2O6 |
| Molecular Weight | 166.09 |
| CAS Registry Number | 6423-43-4 |
| EINECS | 229-180-0 |
| SMILES | C(O[N+]([O-])=O)C(O[N+]([O-])=O)C |
| InChI | 1S/C3H6N2O6/c1-3(11-5(8)9)2-10-4(6)7/h3H,2H2,1H3 |
| InChIKey | PSXCGTLGGVDWFU-UHFFFAOYSA-N |
| Density | 1.423g/cm3 (Cal.) |
|---|---|
| Boiling point | 206.735°C at 760 mmHg (Cal.) |
| Flash point | 98.527°C (Cal.) |
| solubility | 0.1% |
| (1) | Evandro Piccin, Nicolò Dossi, Avi Cagan, Emanuel Carrilho and Joseph Wang. Rapid and sensitive measurements of nitrate ester explosives using microchip electrophoresis with electrochemical detection, Analyst, 2009, 134, 528. |
|---|---|
| Market Analysis Reports |